Organic acids and derivatives
Filtered Search Results
Bromoacetic anhydride, 95%
CAS: 13094-51-4 Molecular Formula: C4H4Br2O3 Molecular Weight (g/mol): 259.87 MDL Number: MFCD00045041 InChI Key: FUKOTTQGWQVMQB-UHFFFAOYSA-N Synonym: bromoacetic anhydride,2-bromoacetic anhydride,acetic acid, 2-bromo-,1,1'-anhydride,2-bromoacetyl 2-bromoacetate,bromoaceticanhydride,acetic acid, bromo-, anhydride PubChem CID: 4259817 IUPAC Name: (2-bromoacetyl) 2-bromoacetate SMILES: C(C(=O)OC(=O)CBr)Br
| PubChem CID | 4259817 |
|---|---|
| CAS | 13094-51-4 |
| Molecular Weight (g/mol) | 259.87 |
| MDL Number | MFCD00045041 |
| SMILES | C(C(=O)OC(=O)CBr)Br |
| Synonym | bromoacetic anhydride,2-bromoacetic anhydride,acetic acid, 2-bromo-,1,1'-anhydride,2-bromoacetyl 2-bromoacetate,bromoaceticanhydride,acetic acid, bromo-, anhydride |
| IUPAC Name | (2-bromoacetyl) 2-bromoacetate |
| InChI Key | FUKOTTQGWQVMQB-UHFFFAOYSA-N |
| Molecular Formula | C4H4Br2O3 |
Mercury(II) trifluoromethanesulfonate, 98%
CAS: 49540-00-3 Molecular Formula: C2F6HgO6S2 Molecular Weight (g/mol): 498.718 MDL Number: MFCD00144746 InChI Key: BPVYMDMPLCOQPJ-UHFFFAOYSA-L Synonym: mercury ii trifluoromethanesulfonate,mercury triflate,mercury 2+ ditriflate,hg otf 2,ksc491a8p,mercury ii trifluoromethanesulphonate,mercury 2+ ; trifluoromethanesulfonate,mercury 2+ ion ditrifluoromethanesulfonate,mercury ii trifluoromethanesulfonate trace metals basis PubChem CID: 2775250 IUPAC Name: mercury(2+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2]
| PubChem CID | 2775250 |
|---|---|
| CAS | 49540-00-3 |
| Molecular Weight (g/mol) | 498.718 |
| MDL Number | MFCD00144746 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Hg+2] |
| Synonym | mercury ii trifluoromethanesulfonate,mercury triflate,mercury 2+ ditriflate,hg otf 2,ksc491a8p,mercury ii trifluoromethanesulphonate,mercury 2+ ; trifluoromethanesulfonate,mercury 2+ ion ditrifluoromethanesulfonate,mercury ii trifluoromethanesulfonate trace metals basis |
| IUPAC Name | mercury(2+);trifluoromethanesulfonate |
| InChI Key | BPVYMDMPLCOQPJ-UHFFFAOYSA-L |
| Molecular Formula | C2F6HgO6S2 |
N-tert-Butylacetamide, 98%
CAS: 762-84-5 Molecular Formula: C6H13NO Molecular Weight (g/mol): 115.176 MDL Number: MFCD00038244 InChI Key: ACYFWRHALJTSCF-UHFFFAOYSA-N Synonym: n-tert-butyl acetamide,tert-butylacetamide,n-t-butylacetamide,acetamide, n-1,1-dimethylethyl,ch3c o nhc ch3 3,acetamide,n-1,1-dimethylethyl PubChem CID: 12985 IUPAC Name: N-tert-butylacetamide SMILES: CC(=O)NC(C)(C)C
| PubChem CID | 12985 |
|---|---|
| CAS | 762-84-5 |
| Molecular Weight (g/mol) | 115.176 |
| MDL Number | MFCD00038244 |
| SMILES | CC(=O)NC(C)(C)C |
| Synonym | n-tert-butyl acetamide,tert-butylacetamide,n-t-butylacetamide,acetamide, n-1,1-dimethylethyl,ch3c o nhc ch3 3,acetamide,n-1,1-dimethylethyl |
| IUPAC Name | N-tert-butylacetamide |
| InChI Key | ACYFWRHALJTSCF-UHFFFAOYSA-N |
| Molecular Formula | C6H13NO |
Methyl benzoate, 99%
CAS: 93-58-3 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00008421 InChI Key: QPJVMBTYPHYUOC-UHFFFAOYSA-N Synonym: methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le PubChem CID: 7150 ChEBI: CHEBI:72775 IUPAC Name: methyl benzoate SMILES: COC(=O)C1=CC=CC=C1
| PubChem CID | 7150 |
|---|---|
| CAS | 93-58-3 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:72775 |
| MDL Number | MFCD00008421 |
| SMILES | COC(=O)C1=CC=CC=C1 |
| Synonym | methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le |
| IUPAC Name | methyl benzoate |
| InChI Key | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
| Physical Form | Solid |
|---|---|
| Melting Point | 220°C to 222°C |
(-)-Gallocatechin gallate
CAS: 4233-96-9 Molecular Formula: C22H18O11 Molecular Weight (g/mol): 458.375 MDL Number: MFCD00214298 InChI Key: WMBWREPUVVBILR-NQIIRXRSSA-N Synonym: =--gallocatechin gallate,gallocatechin gallate,=--gallocatechol gallate,unii-irw3c4y31q,gallocatechin gallate gcg,irw3c4y31q,gallocatechin gallate,-,=--gallocatechin-3-o-gallate,2s,3r-5,7-dihydroxy-2-3,4,5-trihydroxyphenyl chroman-3-yl 3,4,5-trihydroxybenzoate,2s,3r-2-3,4,5-trihydroxyphenyl-3,4-dihydro-1 2h-benzopyran-3,5,7-triol 3-3,4,5-trihydroxybenzoate PubChem CID: 199472 IUPAC Name: [(2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate SMILES: C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O
| PubChem CID | 199472 |
|---|---|
| CAS | 4233-96-9 |
| Molecular Weight (g/mol) | 458.375 |
| MDL Number | MFCD00214298 |
| SMILES | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
| Synonym | =--gallocatechin gallate,gallocatechin gallate,=--gallocatechol gallate,unii-irw3c4y31q,gallocatechin gallate gcg,irw3c4y31q,gallocatechin gallate,-,=--gallocatechin-3-o-gallate,2s,3r-5,7-dihydroxy-2-3,4,5-trihydroxyphenyl chroman-3-yl 3,4,5-trihydroxybenzoate,2s,3r-2-3,4,5-trihydroxyphenyl-3,4-dihydro-1 2h-benzopyran-3,5,7-triol 3-3,4,5-trihydroxybenzoate |
| IUPAC Name | [(2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| InChI Key | WMBWREPUVVBILR-NQIIRXRSSA-N |
| Molecular Formula | C22H18O11 |
Spectrum Chemical Manufacturing Corporation Urea, USP, JP, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N IUPAC Name: urea SMILES: NC(N)=O
| CAS | 57-13-6 |
|---|---|
| Molecular Weight (g/mol) | 60.06 |
| SMILES | NC(N)=O |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Ethyl 1-hydroxycyclopropanecarboxylate, 90%
CAS: 137682-89-4 Molecular Formula: C6H10O3 Molecular Weight (g/mol): 130.14 MDL Number: MFCD01863257 InChI Key: DPMGQZGXWRHYPE-UHFFFAOYSA-N Synonym: ethyl 1-hydroxycyclopropanecarboxylate,1-hydroxycyclopropanecarboxylic acid ethyl ester,cyclopropanecarboxylic acid, 1-hydroxy-, ethyl ester,1-ethoxycarbonyl cyclopropan-1-ol,ethyl-1-hydroxycyclopropane carboxylate,1-hydroxy-cyclopropanecarboxylic acid ethyl ester PubChem CID: 2733706 IUPAC Name: ethyl 1-hydroxycyclopropane-1-carboxylate SMILES: CCOC(=O)C1(O)CC1
| PubChem CID | 2733706 |
|---|---|
| CAS | 137682-89-4 |
| Molecular Weight (g/mol) | 130.14 |
| MDL Number | MFCD01863257 |
| SMILES | CCOC(=O)C1(O)CC1 |
| Synonym | ethyl 1-hydroxycyclopropanecarboxylate,1-hydroxycyclopropanecarboxylic acid ethyl ester,cyclopropanecarboxylic acid, 1-hydroxy-, ethyl ester,1-ethoxycarbonyl cyclopropan-1-ol,ethyl-1-hydroxycyclopropane carboxylate,1-hydroxy-cyclopropanecarboxylic acid ethyl ester |
| IUPAC Name | ethyl 1-hydroxycyclopropane-1-carboxylate |
| InChI Key | DPMGQZGXWRHYPE-UHFFFAOYSA-N |
| Molecular Formula | C6H10O3 |
Ethylenediaminetetraacetic acid manganese disodium salt hydrate
CAS: 15375-84-5 Molecular Formula: C10H12MnN2Na2O8 Molecular Weight (g/mol): 389.13 MDL Number: MFCD00661156 InChI Key: ZQHKAIDDHTYINE-UHFFFAOYSA-J Synonym: disodium manganese edta,edta disodium manganese salt,disodium manganese ethylenediaminetetraacetate,manganese disodium ethylene diamine tetraacetate,ethylenediaminetetraacetic acid, disodium manganese salt,disodium ethylenedinitrilo tetraacetato manganese,manganate 2-, disodium,glycine,n'-1,2-ethanediylbis n-carboxymethyl-, manganese disodium salt,manganate 2-,n'-1,2-ethanediylbis n-carboxymethyl glycinato 4--n,n',o,o',on,on'-, disodium, oc-6-21 PubChem CID: 5148022 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;manganese(2+) SMILES: [Na+].[Na+].[Mn++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 5148022 |
|---|---|
| CAS | 15375-84-5 |
| Molecular Weight (g/mol) | 389.13 |
| MDL Number | MFCD00661156 |
| SMILES | [Na+].[Na+].[Mn++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | disodium manganese edta,edta disodium manganese salt,disodium manganese ethylenediaminetetraacetate,manganese disodium ethylene diamine tetraacetate,ethylenediaminetetraacetic acid, disodium manganese salt,disodium ethylenedinitrilo tetraacetato manganese,manganate 2-, disodium,glycine,n'-1,2-ethanediylbis n-carboxymethyl-, manganese disodium salt,manganate 2-,n'-1,2-ethanediylbis n-carboxymethyl glycinato 4--n,n',o,o',on,on'-, disodium, oc-6-21 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;manganese(2+) |
| InChI Key | ZQHKAIDDHTYINE-UHFFFAOYSA-J |
| Molecular Formula | C10H12MnN2Na2O8 |
4-n-Nonylbenzeneboronic acid, 98+%
CAS: 256383-45-6 Molecular Formula: C15H25BO2 Molecular Weight (g/mol): 248.173 MDL Number: MFCD02093070 InChI Key: VONVJOGSLHAKOX-UHFFFAOYSA-N Synonym: 4-n-nonylphenylboronic acid,4-n-nonylbenzeneboronic acid,4-nonylphenyl boronic acid,4-n-nonylphenylboronicacid,4-nonylphenyl boranediol,d0f1ud,4-nonylbenzene boronic acid,b-4-nonylphenyl boronic acid,4-n-nonyl benzeneboronic acid,1-borono-4-non-1-yl benzene PubChem CID: 4589192 IUPAC Name: (4-nonylphenyl)boronic acid SMILES: B(C1=CC=C(C=C1)CCCCCCCCC)(O)O
| PubChem CID | 4589192 |
|---|---|
| CAS | 256383-45-6 |
| Molecular Weight (g/mol) | 248.173 |
| MDL Number | MFCD02093070 |
| SMILES | B(C1=CC=C(C=C1)CCCCCCCCC)(O)O |
| Synonym | 4-n-nonylphenylboronic acid,4-n-nonylbenzeneboronic acid,4-nonylphenyl boronic acid,4-n-nonylphenylboronicacid,4-nonylphenyl boranediol,d0f1ud,4-nonylbenzene boronic acid,b-4-nonylphenyl boronic acid,4-n-nonyl benzeneboronic acid,1-borono-4-non-1-yl benzene |
| IUPAC Name | (4-nonylphenyl)boronic acid |
| InChI Key | VONVJOGSLHAKOX-UHFFFAOYSA-N |
| Molecular Formula | C15H25BO2 |
tert-Butyl acrylate, 99%, stab. with 15ppm 4-methoxyphenol
CAS: 1663-39-4 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00008809 InChI Key: ISXSCDLOGDJUNJ-UHFFFAOYSA-N Synonym: tert-butyl acrylate,t-butyl acrylate,tert-butyl propenoate,2-propenoic acid, 1,1-dimethylethyl ester,acrylic acid tert-butyl ester,tert-butylacrylate,acrylic acid, tert-butyl ester,unii-92m2cd1o3g,ccris 7035,2-propenoic acid tert-butyl ester PubChem CID: 15458 IUPAC Name: tert-butyl prop-2-enoate SMILES: CC(C)(C)OC(=O)C=C
| PubChem CID | 15458 |
|---|---|
| CAS | 1663-39-4 |
| Molecular Weight (g/mol) | 128.17 |
| MDL Number | MFCD00008809 |
| SMILES | CC(C)(C)OC(=O)C=C |
| Synonym | tert-butyl acrylate,t-butyl acrylate,tert-butyl propenoate,2-propenoic acid, 1,1-dimethylethyl ester,acrylic acid tert-butyl ester,tert-butylacrylate,acrylic acid, tert-butyl ester,unii-92m2cd1o3g,ccris 7035,2-propenoic acid tert-butyl ester |
| IUPAC Name | tert-butyl prop-2-enoate |
| InChI Key | ISXSCDLOGDJUNJ-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
3-Carboxy-4-methoxybenzeneboronic acid, 98%, Thermo Scientific Chemicals
CAS: 913836-12-1 Molecular Formula: C8H9BO5 Molecular Weight (g/mol): 195.965 MDL Number: MFCD06203322 InChI Key: YZKWFWNYFKBAHO-UHFFFAOYSA-N Synonym: 3-carboxy-4-methoxyphenylboronic acid,5-dihydroxyboranyl-2-methoxybenzoic acid,benzoicacid, 5-borono-2-methoxy-9ci,3-carboxy-4-methoxybenzeneboronic acid,benzoic acid, 5-borono-2-methoxy,acmc-209raw,ksc486i0n,5-dihydroxyboryl-2-methoxybenzoic acid PubChem CID: 44119154 IUPAC Name: 5-borono-2-methoxybenzoic acid SMILES: B(C1=CC(=C(C=C1)OC)C(=O)O)(O)O
| PubChem CID | 44119154 |
|---|---|
| CAS | 913836-12-1 |
| Molecular Weight (g/mol) | 195.965 |
| MDL Number | MFCD06203322 |
| SMILES | B(C1=CC(=C(C=C1)OC)C(=O)O)(O)O |
| Synonym | 3-carboxy-4-methoxyphenylboronic acid,5-dihydroxyboranyl-2-methoxybenzoic acid,benzoicacid, 5-borono-2-methoxy-9ci,3-carboxy-4-methoxybenzeneboronic acid,benzoic acid, 5-borono-2-methoxy,acmc-209raw,ksc486i0n,5-dihydroxyboryl-2-methoxybenzoic acid |
| IUPAC Name | 5-borono-2-methoxybenzoic acid |
| InChI Key | YZKWFWNYFKBAHO-UHFFFAOYSA-N |
| Molecular Formula | C8H9BO5 |
1-Cyclopropyl-1H-pyrazole-4-boronic acid pinacol ester, 97%
CAS: 1151802-22-0 Molecular Formula: C12H19BN2O2 Molecular Weight (g/mol): 234.106 MDL Number: MFCD16659007 InChI Key: NLWYVKHISUTBMY-UHFFFAOYSA-N Synonym: 1-cyclopropyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-1h-pyrazole,1-cyclopropyl-1h-pyrazole-4-boronic acid pinacol ester,1-cyclopropyl-4-tetramethyl-1,3,2-dioxaborolan-2-yl-1h-pyrazole,1-cyclopropyl-4-4,4,5,5-tetramethyl-1,3,2-di...,1-cyclopropyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl pyrazole,1-cyclopropyl-4-pinacolylboronate-pyrazole,1-cyclopropy-1-yl-boronic acid pinacol ester,1-cyclopropyl 1h-pyrazole-4-boronic acid pinacol ester,1h-pyrazole,1-cyclopropyl-4-4,4,5,5-tetramethyl-1,1-cyclopropyl-1h-pyrazol-4-yl boronic acid pinacol ester PubChem CID: 59327133 IUPAC Name: 1-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole SMILES: B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3CC3
| PubChem CID | 59327133 |
|---|---|
| CAS | 1151802-22-0 |
| Molecular Weight (g/mol) | 234.106 |
| MDL Number | MFCD16659007 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3CC3 |
| Synonym | 1-cyclopropyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-1h-pyrazole,1-cyclopropyl-1h-pyrazole-4-boronic acid pinacol ester,1-cyclopropyl-4-tetramethyl-1,3,2-dioxaborolan-2-yl-1h-pyrazole,1-cyclopropyl-4-4,4,5,5-tetramethyl-1,3,2-di...,1-cyclopropyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl pyrazole,1-cyclopropyl-4-pinacolylboronate-pyrazole,1-cyclopropy-1-yl-boronic acid pinacol ester,1-cyclopropyl 1h-pyrazole-4-boronic acid pinacol ester,1h-pyrazole,1-cyclopropyl-4-4,4,5,5-tetramethyl-1,1-cyclopropyl-1h-pyrazol-4-yl boronic acid pinacol ester |
| IUPAC Name | 1-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChI Key | NLWYVKHISUTBMY-UHFFFAOYSA-N |
| Molecular Formula | C12H19BN2O2 |
Tetramethyl methylenediphosphonate, 98+%
CAS: 16001-93-7 Molecular Formula: C5H14O6P2 Molecular Weight (g/mol): 232.109 MDL Number: MFCD00014884 InChI Key: XAVFZUKFLWOSOS-UHFFFAOYSA-N Synonym: tetramethyl methylenediphosphonate,bis dimethoxyphosphoryl methane,tetramethyl methylenebis phosphonate,phosphonic acid, methylenebis-, tetramethyl ester,acmc-20ajjd,tetramethyl methanebisphosphonate,tetramethyl-methylenediphosphonate,tetramethyl methylenebisphosphonate,methylenebis phosphonic acid dimethyl ester,methylenediphosphonic acid tetramethyl ester PubChem CID: 519206 IUPAC Name: bis(dimethoxyphosphoryl)methane SMILES: COP(=O)(CP(=O)(OC)OC)OC
| PubChem CID | 519206 |
|---|---|
| CAS | 16001-93-7 |
| Molecular Weight (g/mol) | 232.109 |
| MDL Number | MFCD00014884 |
| SMILES | COP(=O)(CP(=O)(OC)OC)OC |
| Synonym | tetramethyl methylenediphosphonate,bis dimethoxyphosphoryl methane,tetramethyl methylenebis phosphonate,phosphonic acid, methylenebis-, tetramethyl ester,acmc-20ajjd,tetramethyl methanebisphosphonate,tetramethyl-methylenediphosphonate,tetramethyl methylenebisphosphonate,methylenebis phosphonic acid dimethyl ester,methylenediphosphonic acid tetramethyl ester |
| IUPAC Name | bis(dimethoxyphosphoryl)methane |
| InChI Key | XAVFZUKFLWOSOS-UHFFFAOYSA-N |
| Molecular Formula | C5H14O6P2 |
Diethyl phenylthiomethylphosphonate, 96%
CAS: 38066-16-9 Molecular Formula: C11H17O3PS Molecular Weight (g/mol): 260.288 MDL Number: MFCD00015130 InChI Key: FBUXEPJJFVDUFE-UHFFFAOYSA-N Synonym: diethyl phenylthiomethylphosphonate,diethyl phenylthio methyl phosphonate,diethyl phenylsulfanyl methylphosphonate,phosphonic acid, phenylthio methyl-, diethyl ester,diethoxy phenylthiomethyl phosphino-1-one,diethylphenylthiomethylphosphonate,acmc-1bn85,diethyl-phenylthiomethylphosphonate,diethyl methylthiobenzyl phosphonate,diethyl phenylsulfanyl methylphosphonate # PubChem CID: 99227 IUPAC Name: diethoxyphosphorylmethylsulfanylbenzene SMILES: CCOP(=O)(CSC1=CC=CC=C1)OCC
| PubChem CID | 99227 |
|---|---|
| CAS | 38066-16-9 |
| Molecular Weight (g/mol) | 260.288 |
| MDL Number | MFCD00015130 |
| SMILES | CCOP(=O)(CSC1=CC=CC=C1)OCC |
| Synonym | diethyl phenylthiomethylphosphonate,diethyl phenylthio methyl phosphonate,diethyl phenylsulfanyl methylphosphonate,phosphonic acid, phenylthio methyl-, diethyl ester,diethoxy phenylthiomethyl phosphino-1-one,diethylphenylthiomethylphosphonate,acmc-1bn85,diethyl-phenylthiomethylphosphonate,diethyl methylthiobenzyl phosphonate,diethyl phenylsulfanyl methylphosphonate # |
| IUPAC Name | diethoxyphosphorylmethylsulfanylbenzene |
| InChI Key | FBUXEPJJFVDUFE-UHFFFAOYSA-N |
| Molecular Formula | C11H17O3PS |